C15H16Cl2N2O3 — CID 7169258
cyanomethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoate (PubChem CID 7169258) has the molecular formula C15H16Cl2N2O3 and a molecular weight of 343.21 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoate.
| Compound Name | cyanomethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 7169258 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | cyanomethyl (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)OCC#N |
| InChI | InChI=1S/C15H16Cl2N2O3/c1-9(2)7-13(15(21)22-6-5-18)19-14(20)11-4-3-10(16)8-12(11)17/h3-4,8-9,13H,6-7H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | SPXJTPNONYVSMH-ZDUSSCGKSA-N |
| XLogP | 3.20 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |