C17H21ClN2O3 — CID 55355112
3-cyanopropyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate (PubChem CID 55355112) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 3-cyanopropyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate.
| Compound Name | 3-cyanopropyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 55355112 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-cyanopropyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1)C(=O)OCCCC#N |
| InChI | InChI=1S/C17H21ClN2O3/c1-12(2)11-15(17(22)23-10-4-3-9-19)20-16(21)13-5-7-14(18)8-6-13/h5-8,12,15H,3-4,10-11H2,1-2H3,(H,20,21) |
| InChIKey | IIDZFEREHZRFSO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|