C20H20Cl2FNO3 — CID 7351617
(2-chloro-6-fluorophenyl)methyl (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate (PubChem CID 7351617) has the molecular formula C20H20Cl2FNO3 and a molecular weight of 412.29 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 7351617 |
| Molecular Formula | C20H20Cl2FNO3 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl (2S)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H20Cl2FNO3/c1-12(2)10-18(24-19(25)13-6-8-14(21)9-7-13)20(26)27-11-15-16(22)4-3-5-17(15)23/h3-9,12,18H,10-11H2,1-2H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | PNXUGBOISDSKTI-SFHVURJKSA-N |
| XLogP | 5.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |