C17H21ClN2O5 — CID 2128639
(2-acetamido-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate (PubChem CID 2128639) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is (2-acetamido-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate.
| Compound Name | (2-acetamido-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 2128639 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (2-acetamido-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
| SMILES | CC(=O)NC(=O)COC(=O)[C@@H](CC(C)C)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O5/c1-10(2)8-14(17(24)25-9-15(22)19-11(3)21)20-16(23)12-4-6-13(18)7-5-12/h4-7,10,14H,8-9H2,1-3H3,(H,20,23)(H,19,21,22)/t14-/m1/s1 |
| InChIKey | XVRVQGQOIUMWTN-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |