C17H21ClFNO5 — CID 9202776
methyl (2R)-2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]-4-methylpentanoate (PubChem CID 9202776) has the molecular formula C17H21ClFNO5 and a molecular weight of 373.81 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 9202776 |
| Molecular Formula | C17H21ClFNO5 |
| Molecular Weight | 373.81 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | methyl (2R)-2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H21ClFNO5/c1-10(2)7-14(17(23)24-3)20-15(21)9-25-16(22)8-11-12(18)5-4-6-13(11)19/h4-6,10,14H,7-9H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | IIXHTDOOKAZGJC-CQSZACIVSA-N |
| XLogP | 2.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.81 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |