C18H15ClFNO5 — CID 7718380
methyl 2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 7718380) has the molecular formula C18H15ClFNO5 and a molecular weight of 379.77 g/mol. Its IUPAC name is methyl 2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7718380 |
| Molecular Formula | C18H15ClFNO5 |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | methyl 2-[[2-[2-(2-chloro-6-fluorophenyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H15ClFNO5/c1-25-18(24)11-5-2-3-8-15(11)21-16(22)10-26-17(23)9-12-13(19)6-4-7-14(12)20/h2-8H,9-10H2,1H3,(H,21,22) |
| InChIKey | NKCKIQIXAGBPHX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |