C17H13ClF2N2O4 — CID 7718250
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718250) has the molecular formula C17H13ClF2N2O4 and a molecular weight of 382.75 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718250 |
| Molecular Formula | C17H13ClF2N2O4 |
| Molecular Weight | 382.75 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1c(F)cccc1Cl)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H13ClF2N2O4/c18-12-5-3-7-14(20)11(12)8-16(24)26-9-15(23)21-22-17(25)10-4-1-2-6-13(10)19/h1-7H,8-9H2,(H,21,23)(H,22,25) |
| InChIKey | YJNJHZUXCZCKOS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.75 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|