C16H18ClF2NO5 — CID 9229704
[2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 9229704) has the molecular formula C16H18ClF2NO5 and a molecular weight of 377.77 g/mol. Its IUPAC name is [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 9229704 |
| Molecular Formula | C16H18ClF2NO5 |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H18ClF2NO5/c1-8(2)4-13(16(23)24-3)20-14(21)7-25-15(22)9-5-11(18)12(19)6-10(9)17/h5-6,8,13H,4,7H2,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | ULOXWWMHTBZFAD-CYBMUJFWSA-N |
| XLogP | 2.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|