C17H23NO5S — CID 8841113
[2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate (PubChem CID 8841113) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate.
| Compound Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8841113 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)c1ccccc1SC |
| InChI | InChI=1S/C17H23NO5S/c1-11(2)9-13(17(21)22-3)18-15(19)10-23-16(20)12-7-5-6-8-14(12)24-4/h5-8,11,13H,9-10H2,1-4H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | OIMQEAGYFFKPMD-CYBMUJFWSA-N |
| XLogP | 2.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |