C18H18BrNO3S — CID 8526328
[2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate (PubChem CID 8526328) has the molecular formula C18H18BrNO3S and a molecular weight of 408.32 g/mol. Its IUPAC name is [2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate.
| Compound Name | [2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8526328 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | [2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)OCC(=O)N[C@H](C)c1ccccc1Br |
| InChI | InChI=1S/C18H18BrNO3S/c1-12(13-7-3-5-9-15(13)19)20-17(21)11-23-18(22)14-8-4-6-10-16(14)24-2/h3-10,12H,11H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | ZANZAGXRXIRVEU-GFCCVEGCSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |