C18H15BrN2O3 — CID 8018188
[2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 8018188) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is [2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018188 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | [2-[[(1R)-1-(2-bromophenyl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc(C#N)cc1)c1ccccc1Br |
| InChI | InChI=1S/C18H15BrN2O3/c1-12(15-4-2-3-5-16(15)19)21-17(22)11-24-18(23)14-8-6-13(10-20)7-9-14/h2-9,12H,11H2,1H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | UEAJXDCQXXYHMQ-GFCCVEGCSA-N |
| XLogP | 3.35 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |