C16H14N2O4 — CID 9201966
[2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate (PubChem CID 9201966) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate.
| Compound Name | [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 9201966 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-cyanobenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccc(C#N)cc1)c1ccco1 |
| InChI | InChI=1S/C16H14N2O4/c1-11(14-3-2-8-21-14)18-15(19)10-22-16(20)13-6-4-12(9-17)5-7-13/h2-8,11H,10H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | WLOVNFQFPYUHOG-NSHDSACASA-N |
| XLogP | 2.19 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |