C19H22N2O5 — CID 41324398
[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-(2-acetamidoethyl)benzoate (PubChem CID 41324398) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-(2-acetamidoethyl)benzoate.
| Compound Name | [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-(2-acetamidoethyl)benzoate |
|---|---|
| PubChem CID | 41324398 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 4-(2-acetamidoethyl)benzoate |
| SMILES | CC(=O)NCCc1ccc(C(=O)OCC(=O)N[C@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C19H22N2O5/c1-13(17-4-3-11-25-17)21-18(23)12-26-19(24)16-7-5-15(6-8-16)9-10-20-14(2)22/h3-8,11,13H,9-10,12H2,1-2H3,(H,20,22)(H,21,23)/t13-/m1/s1 |
| InChIKey | OCOHECUBEMQAHL-CYBMUJFWSA-N |
| XLogP | 1.99 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |