C17H19NO5 — CID 9197604
[2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 9197604) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 9197604 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [2-[[(1S)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)N[C@@H](C)c1ccco1 |
| InChI | InChI=1S/C17H19NO5/c1-3-21-15-8-5-4-7-13(15)17(20)23-11-16(19)18-12(2)14-9-6-10-22-14/h4-10,12H,3,11H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | ASGGXSJKUJEWIS-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |