C23H23NO6 — CID 9492458
[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate (PubChem CID 9492458) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate.
| Compound Name | [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 9492458 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 2-(2-phenoxyethoxy)benzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccccc1OCCOc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C23H23NO6/c1-17(20-12-7-13-28-20)24-22(25)16-30-23(26)19-10-5-6-11-21(19)29-15-14-27-18-8-3-2-4-9-18/h2-13,17H,14-16H2,1H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | BXOLGNJOLAGTRP-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|