C14H14ClNO3 — CID 9011821
2-(2-chlorophenoxy)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 9011821) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 9011821 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)COc1ccccc1Cl)c1ccco1 |
| InChI | InChI=1S/C14H14ClNO3/c1-10(12-7-4-8-18-12)16-14(17)9-19-13-6-3-2-5-11(13)15/h2-8,10H,9H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | HZWLKWZAOOPJCZ-SNVBAGLBSA-N |
| XLogP | 3.19 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |