C10H13NO5 — CID 81408914
2-[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 81408914) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 81408914 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | C[C@@H](NC(=O)COCC(=O)O)c1ccco1 |
| InChI | InChI=1S/C10H13NO5/c1-7(8-3-2-4-16-8)11-9(12)5-15-6-10(13)14/h2-4,7H,5-6H2,1H3,(H,11,12)(H,13,14)/t7-/m1/s1 |
| InChIKey | RAXYCSCVUZJECR-SSDOTTSWSA-N |
| XLogP | 0.56 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |