C14H15NO2S — CID 9482011
N-[(1S)-1-(furan-2-yl)ethyl]-2-phenylsulfanylacetamide (PubChem CID 9482011) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[(1S)-1-(furan-2-yl)ethyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 9482011 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-[(1S)-1-(furan-2-yl)ethyl]-2-phenylsulfanylacetamide |
| SMILES | C[C@H](NC(=O)CSc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C14H15NO2S/c1-11(13-8-5-9-17-13)15-14(16)10-18-12-6-3-2-4-7-12/h2-9,11H,10H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | TWELNWGSACVSAV-NSHDSACASA-N |
| XLogP | 3.25 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |