C16H17NOS — CID 2889950
N-(1-phenylethyl)-2-phenylsulfanylacetamide (PubChem CID 2889950) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is N-(1-phenylethyl)-2-phenylsulfanylacetamide.
| Compound Name | N-(1-phenylethyl)-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2889950 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(1-phenylethyl)-2-phenylsulfanylacetamide |
| SMILES | CC(NC(=O)CSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NOS/c1-13(14-8-4-2-5-9-14)17-16(18)12-19-15-10-6-3-7-11-15/h2-11,13H,12H2,1H3,(H,17,18) |
| InChIKey | IMKDWHSFLXKZTF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |