C14H14FNO2S — CID 95279801
2-(2-fluorophenyl)sulfanyl-N-[(1R)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 95279801) has the molecular formula C14H14FNO2S and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[(1R)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 95279801 |
| Molecular Formula | C14H14FNO2S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[(1R)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CSc1ccccc1F)c1ccco1 |
| InChI | InChI=1S/C14H14FNO2S/c1-10(12-6-4-8-18-12)16-14(17)9-19-13-7-3-2-5-11(13)15/h2-8,10H,9H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | SVXMDQLKANYCLP-SNVBAGLBSA-N |
| XLogP | 3.39 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |