C17H18FNO3S2 — CID 51247307
2-(2-fluorophenyl)sulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 51247307) has the molecular formula C17H18FNO3S2 and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 51247307 |
| Molecular Formula | C17H18FNO3S2 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CSc1ccccc1F)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18FNO3S2/c1-12(13-7-9-14(10-8-13)24(2,21)22)19-17(20)11-23-16-6-4-3-5-15(16)18/h3-10,12H,11H2,1-2H3,(H,19,20) |
| InChIKey | VWRDEMBLNHZGEV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |