C16H16F2N2O3S2 — CID 8633334
2-(2,4-difluorophenyl)sulfanyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 8633334) has the molecular formula C16H16F2N2O3S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8633334 |
| Molecular Formula | C16H16F2N2O3S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CSc1ccc(F)cc1F)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16F2N2O3S2/c1-10(11-2-5-13(6-3-11)25(19,22)23)20-16(21)9-24-15-7-4-12(17)8-14(15)18/h2-8,10H,9H2,1H3,(H,20,21)(H2,19,22,23)/t10-/m0/s1 |
| InChIKey | NSBVXPRHKYAWRE-JTQLQIEISA-N |
| XLogP | 2.58 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |