C12H17NO3S — CID 92510485
N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]propanamide (PubChem CID 92510485) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]propanamide.
| Compound Name | N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 92510485 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]propanamide |
| SMILES | CCC(=O)N[C@@H](C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-4-12(14)13-9(2)10-5-7-11(8-6-10)17(3,15)16/h5-9H,4H2,1-3H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | MUATXWSAPJCXQL-VIFPVBQESA-N |
| XLogP | 1.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |