C13H17NO3S — CID 36687848
N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide (PubChem CID 36687848) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 36687848 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]cyclopropanecarboxamide |
| SMILES | C[C@H](NC(=O)C1CC1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-9(14-13(15)11-3-4-11)10-5-7-12(8-6-10)18(2,16)17/h5-9,11H,3-4H2,1-2H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | VSXNGMPQSYXFDU-VIFPVBQESA-N |
| XLogP | 1.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |