C19H24N2O5S3 — CID 26468180
N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 26468180) has the molecular formula C19H24N2O5S3 and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26468180 |
| Molecular Formula | C19H24N2O5S3 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H24N2O5S3/c1-14(15-5-7-17(8-6-15)28(2,23)24)20-19(22)16-9-11-21(12-10-16)29(25,26)18-4-3-13-27-18/h3-8,13-14,16H,9-12H2,1-2H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | KQHXMXUDWJKJOH-CQSZACIVSA-N |
| XLogP | 2.43 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |