C14H20N2O3S — CID 60711733
N-[1-(4-methylsulfonylphenyl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 60711733) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[1-(4-methylsulfonylphenyl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[1-(4-methylsulfonylphenyl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60711733 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[1-(4-methylsulfonylphenyl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(NC(=O)C1CCCN1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-10(16-14(17)13-4-3-9-15-13)11-5-7-12(8-6-11)20(2,18)19/h5-8,10,13,15H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | PREBDZQZDBAMJQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |