C16H25N3O4S — CID 55924438
3-[1-(4-methylsulfonylphenyl)ethylcarbamoylamino]-N-propylpropanamide (PubChem CID 55924438) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 3-[1-(4-methylsulfonylphenyl)ethylcarbamoylamino]-N-propylpropanamide.
| Compound Name | 3-[1-(4-methylsulfonylphenyl)ethylcarbamoylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 55924438 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[1-(4-methylsulfonylphenyl)ethylcarbamoylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNC(=O)NC(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H25N3O4S/c1-4-10-17-15(20)9-11-18-16(21)19-12(2)13-5-7-14(8-6-13)24(3,22)23/h5-8,12H,4,9-11H2,1-3H3,(H,17,20)(H2,18,19,21) |
| InChIKey | ADPAYLQIVBKKDM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |