C18H21BrN2O5S2 — CID 55433081
3-[(4-bromophenyl)sulfonylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide (PubChem CID 55433081) has the molecular formula C18H21BrN2O5S2 and a molecular weight of 489.41 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 55433081 |
| Molecular Formula | C18H21BrN2O5S2 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21BrN2O5S2/c1-13(14-3-7-16(8-4-14)27(2,23)24)21-18(22)11-12-20-28(25,26)17-9-5-15(19)6-10-17/h3-10,13,20H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | PFQBDDXRKLMXKH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |