C18H18BrF3N2O3S — CID 112763964
3-[(4-bromophenyl)sulfonylamino]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide (PubChem CID 112763964) has the molecular formula C18H18BrF3N2O3S and a molecular weight of 479.32 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 112763964 |
| Molecular Formula | C18H18BrF3N2O3S |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]propanamide |
| SMILES | CC(NC(=O)CCNS(=O)(=O)c1ccc(Br)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18BrF3N2O3S/c1-12(13-3-2-4-14(11-13)18(20,21)22)24-17(25)9-10-23-28(26,27)16-7-5-15(19)6-8-16/h2-8,11-12,23H,9-10H2,1H3,(H,24,25) |
| InChIKey | IATWSVLVLDPYGA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |