C20H26N2O3S — CID 52520679
1-[2-(2,4-dimethylphenyl)ethyl]-3-[(1S)-1-(4-methylsulfonylphenyl)ethyl]urea (PubChem CID 52520679) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)ethyl]-3-[(1S)-1-(4-methylsulfonylphenyl)ethyl]urea.
| Compound Name | 1-[2-(2,4-dimethylphenyl)ethyl]-3-[(1S)-1-(4-methylsulfonylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 52520679 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)ethyl]-3-[(1S)-1-(4-methylsulfonylphenyl)ethyl]urea |
| SMILES | Cc1ccc(CCNC(=O)N[C@@H](C)c2ccc(S(C)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C20H26N2O3S/c1-14-5-6-17(15(2)13-14)11-12-21-20(23)22-16(3)18-7-9-19(10-8-18)26(4,24)25/h5-10,13,16H,11-12H2,1-4H3,(H2,21,22,23)/t16-/m0/s1 |
| InChIKey | OFYMSAWFTQAVDX-INIZCTEOSA-N |
| XLogP | 3.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |