C15H24N2O2 — CID 48718367
1-[2-(2,4-dimethylphenyl)ethyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 48718367) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)ethyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[2-(2,4-dimethylphenyl)ethyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 48718367 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)ethyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)NCCc1ccc(C)cc1C |
| InChI | InChI=1S/C15H24N2O2/c1-4-14(10-18)17-15(19)16-8-7-13-6-5-11(2)9-12(13)3/h5-6,9,14,18H,4,7-8,10H2,1-3H3,(H2,16,17,19) |
| InChIKey | YNARREJZENGSPR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |