C12H18N2O5 — CID 60662226
2-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 60662226) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 60662226 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[2-[[2-(dimethylamino)-2-(furan-2-yl)ethyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | CN(C)C(CNC(=O)COCC(=O)O)c1ccco1 |
| InChI | InChI=1S/C12H18N2O5/c1-14(2)9(10-4-3-5-19-10)6-13-11(15)7-18-8-12(16)17/h3-5,9H,6-8H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | RZXZDFOGEJWKIW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |