C15H19ClN2O2 — CID 20994951
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzamide;hydrochloride (PubChem CID 20994951) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 20994951 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]benzamide;hydrochloride |
| SMILES | CN(C)C(CNC(=O)c1ccccc1)c1ccco1.Cl |
| InChI | InChI=1S/C15H18N2O2.ClH/c1-17(2)13(14-9-6-10-19-14)11-16-15(18)12-7-4-3-5-8-12;/h3-10,13H,11H2,1-2H3,(H,16,18);1H |
| InChIKey | PGESKIVDKNZQGE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |