C23H29N5O4 — CID 46604974
2-N,6-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]pyridine-2,6-dicarboxamide (PubChem CID 46604974) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-N,6-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 46604974 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 2-N,6-N-bis[2-(dimethylamino)-2-(furan-2-yl)ethyl]pyridine-2,6-dicarboxamide |
| SMILES | CN(C)C(CNC(=O)c1cccc(C(=O)NCC(c2ccco2)N(C)C)n1)c1ccco1 |
| InChI | InChI=1S/C23H29N5O4/c1-27(2)18(20-10-6-12-31-20)14-24-22(29)16-8-5-9-17(26-16)23(30)25-15-19(28(3)4)21-11-7-13-32-21/h5-13,18-19H,14-15H2,1-4H3,(H,24,29)(H,25,30) |
| InChIKey | YXRHKCVSWUWEBD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |