C16H17F3N2O2 — CID 4803620
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 4803620) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4803620 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CN(C)C(CNC(=O)c1cccc(C(F)(F)F)c1)c1ccco1 |
| InChI | InChI=1S/C16H17F3N2O2/c1-21(2)13(14-7-4-8-23-14)10-20-15(22)11-5-3-6-12(9-11)16(17,18)19/h3-9,13H,10H2,1-2H3,(H,20,22) |
| InChIKey | HQGXNVWYVJRNIR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |