C17H22N2O3 — CID 19114396
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-methylphenoxy)acetamide (PubChem CID 19114396) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 19114396 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-(2-methylphenoxy)acetamide |
| SMILES | Cc1ccccc1OCC(=O)NCC(c1ccco1)N(C)C |
| InChI | InChI=1S/C17H22N2O3/c1-13-7-4-5-8-15(13)22-12-17(20)18-11-14(19(2)3)16-9-6-10-21-16/h4-10,14H,11-12H2,1-3H3,(H,18,20) |
| InChIKey | XFJBMOPWMSPPRP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |