C12H20N2O3 — CID 95236001
N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxyacetamide (PubChem CID 95236001) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxyacetamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 95236001 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NC[C@@H](c1ccco1)N(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-4-16-9-12(15)13-8-10(14(2)3)11-6-5-7-17-11/h5-7,10H,4,8-9H2,1-3H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | WWFZECWLCILENU-JTQLQIEISA-N |
| XLogP | 1.03 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |