C13H23ClN2O2 — CID 52985245
N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-methylbutanamide;hydrochloride (PubChem CID 52985245) has the molecular formula C13H23ClN2O2 and a molecular weight of 274.79 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-methylbutanamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 52985245 |
| Molecular Formula | C13H23ClN2O2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-methylbutanamide;hydrochloride |
| SMILES | CC(C)CC(=O)NCC(c1ccco1)N(C)C.Cl |
| InChI | InChI=1S/C13H22N2O2.ClH/c1-10(2)8-13(16)14-9-11(15(3)4)12-6-5-7-17-12;/h5-7,10-11H,8-9H2,1-4H3,(H,14,16);1H |
| InChIKey | VZKDEWHEZGWALZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |