C13H22N2O3 — CID 94775937
(2S)-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxypropanamide (PubChem CID 94775937) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxypropanamide.
| Compound Name | (2S)-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxypropanamide |
|---|---|
| PubChem CID | 94775937 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (2S)-N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-ethoxypropanamide |
| SMILES | CCO[C@@H](C)C(=O)NC[C@H](c1ccco1)N(C)C |
| InChI | InChI=1S/C13H22N2O3/c1-5-17-10(2)13(16)14-9-11(15(3)4)12-7-6-8-18-12/h6-8,10-11H,5,9H2,1-4H3,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | RGCQVRUKRFGYLC-WDEREUQCSA-N |
| XLogP | 1.42 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |