C16H29N3O2 — CID 65292308
6-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methylheptanamide (PubChem CID 65292308) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 6-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methylheptanamide.
| Compound Name | 6-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methylheptanamide |
|---|---|
| PubChem CID | 65292308 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 6-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-2-methylheptanamide |
| SMILES | CC(N)CCCC(C)C(=O)NCC(c1ccco1)N(C)C |
| InChI | InChI=1S/C16H29N3O2/c1-12(7-5-8-13(2)17)16(20)18-11-14(19(3)4)15-9-6-10-21-15/h6,9-10,12-14H,5,7-8,11,17H2,1-4H3,(H,18,20) |
| InChIKey | CJGXRAMMMYZREH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |