C12H20N4O3 — CID 61247741
2-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]butanediamide (PubChem CID 61247741) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]butanediamide.
| Compound Name | 2-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]butanediamide |
|---|---|
| PubChem CID | 61247741 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-amino-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]butanediamide |
| SMILES | CN(C)C(CNC(=O)C(N)CC(N)=O)c1ccco1 |
| InChI | InChI=1S/C12H20N4O3/c1-16(2)9(10-4-3-5-19-10)7-15-12(18)8(13)6-11(14)17/h3-5,8-9H,6-7,13H2,1-2H3,(H2,14,17)(H,15,18) |
| InChIKey | HXGUWGJPJFICJO-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |