C19H21NO7 — CID 9290334
[2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 9290334) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 9290334 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-[[(2R)-1-methoxy-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)COC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H21NO7/c1-11(2)8-14(19(24)25-3)20-16(21)10-26-17(22)13-9-12-6-4-5-7-15(12)27-18(13)23/h4-7,9,11,14H,8,10H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | RLPIGDDRKICDGX-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|