C17H19NO5 — CID 7785481
[2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 7785481) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 7785481 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [2-[[(2S)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | CC(C)[C@H](C)NC(=O)COC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H19NO5/c1-10(2)11(3)18-15(19)9-22-16(20)13-8-12-6-4-5-7-14(12)23-17(13)21/h4-8,10-11H,9H2,1-3H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | QVSSXPBKDJDRRH-NSHDSACASA-N |
| XLogP | 2.11 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|