C19H14INO5 — CID 2353597
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 2353597) has the molecular formula C19H14INO5 and a molecular weight of 463.23 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 2353597 |
| Molecular Formula | C19H14INO5 |
| Molecular Weight | 463.23 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | Cc1cc(I)ccc1NC(=O)COC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H14INO5/c1-11-8-13(20)6-7-15(11)21-17(22)10-25-18(23)14-9-12-4-2-3-5-16(12)26-19(14)24/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | JYWXNJPWEPJFCT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|