C16H14INO4 — CID 3498018
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 3498018) has the molecular formula C16H14INO4 and a molecular weight of 411.20 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 3498018 |
| Molecular Formula | C16H14INO4 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | Cc1cc(I)ccc1NC(=O)COC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H14INO4/c1-10-8-12(17)4-7-14(10)18-15(20)9-22-16(21)11-2-5-13(19)6-3-11/h2-8,19H,9H2,1H3,(H,18,20) |
| InChIKey | JFMBBILWHJWYPN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|