C15H14INO2S — CID 61031719
2-(4-hydroxyphenyl)sulfanyl-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 61031719) has the molecular formula C15H14INO2S and a molecular weight of 399.25 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)sulfanyl-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-(4-hydroxyphenyl)sulfanyl-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 61031719 |
| Molecular Formula | C15H14INO2S |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | 2-(4-hydroxyphenyl)sulfanyl-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSc1ccc(O)cc1 |
| InChI | InChI=1S/C15H14INO2S/c1-10-8-11(16)2-7-14(10)17-15(19)9-20-13-5-3-12(18)4-6-13/h2-8,18H,9H2,1H3,(H,17,19) |
| InChIKey | OQGNHHFTBACZDT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|