C11H15IN2OS — CID 43249676
2-(2-aminoethylsulfanyl)-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 43249676) has the molecular formula C11H15IN2OS and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43249676 |
| Molecular Formula | C11H15IN2OS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)CSCCN |
| InChI | InChI=1S/C11H15IN2OS/c1-8-6-9(12)2-3-10(8)14-11(15)7-16-5-4-13/h2-3,6H,4-5,7,13H2,1H3,(H,14,15) |
| InChIKey | RXIYQZJKMUNVOS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|