C11H15N3O3S — CID 134064971
2-(2-aminoethylsulfanyl)-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 134064971) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 134064971 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSCCN |
| InChI | InChI=1S/C11H15N3O3S/c1-8-6-9(14(16)17)2-3-10(8)13-11(15)7-18-5-4-12/h2-3,6H,4-5,7,12H2,1H3,(H,13,15) |
| InChIKey | LJDBMLQHORDXKG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|