C16H14Cl2N2O3S — CID 17309830
2-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 17309830) has the molecular formula C16H14Cl2N2O3S and a molecular weight of 385.27 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17309830 |
| Molecular Formula | C16H14Cl2N2O3S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O3S/c1-10-6-12(20(22)23)3-5-15(10)19-16(21)9-24-8-11-2-4-13(17)14(18)7-11/h2-7H,8-9H2,1H3,(H,19,21) |
| InChIKey | IDFIYLKWROVWMG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|