C15H11Cl2N5O3S — CID 35950250
2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 35950250) has the molecular formula C15H11Cl2N5O3S and a molecular weight of 412.26 g/mol. Its IUPAC name is 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 35950250 |
| Molecular Formula | C15H11Cl2N5O3S |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 2-[(6,8-dichloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)sulfanyl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nnc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C15H11Cl2N5O3S/c1-8-4-10(22(24)25)2-3-12(8)18-13(23)7-26-15-20-19-14-11(17)5-9(16)6-21(14)15/h2-6H,7H2,1H3,(H,18,23) |
| InChIKey | MZGZRIWUHGSKFB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|